cas: 119-52-8 — see every product listed under this CAS number, including other names
2-Hydroxy-1,2-bis(4-methoxyphenyl)ethanone, 97%, 97% (CAS 119-52-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NWN-5g |
| cas | 119-52-8 |
| size | 5g |
| availability | 895.67g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 294.80 Pln | |
| Chemat | 500g | 1166.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone (CAS 119-52-8) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone. InChIKey: LRRQSCPPOIUNGX-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| InChIKey | LRRQSCPPOIUNGX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)OC)O |
Computed by PubChem (NCBI)