CAS 119-52-8 appears in our catalog under these names: Anisoin, 97%, 4,4′–Dimethoxybenzoin, Anisoin, 97% , Anisoin, Anisoin, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 100g, 25g, 5g, 500g, 0,1kg, 0,25kg, 0,5kg.
2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone (CAS 119-52-8) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone. InChIKey: LRRQSCPPOIUNGX-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| InChIKey | LRRQSCPPOIUNGX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)OC)O |
Computed by PubChem (NCBI)