cas: 119-52-8 — see every product listed under this CAS number, including other names
2-Hydroxy-1,2-bis(4-methoxyphenyl)ethanone, 98% (CAS 119-52-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224559-10G |
| cas | 119-52-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 487.35 Pln | |
| Fluorochem | 500g | 1794.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone (CAS 119-52-8) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone. InChIKey: LRRQSCPPOIUNGX-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| InChIKey | LRRQSCPPOIUNGX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)OC)O |
Computed by PubChem (NCBI)