cas: 4487-51-8 — see every product listed under this CAS number, including other names
2-Hydroxy-4-nitropyridine 98% (CAS 4487-51-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469476-100mg |
| cas | 4487-51-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 3123.81 Pln | |
| Ambeed | 10g | 4959.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A469476 |
4-nitro-1H-pyridin-2-one (CAS 4487-51-8) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitro-1H-pyridin-2-one. InChIKey: STJAXIFXCBWILG-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitro-1H-pyridin-2-one |
| InChIKey | STJAXIFXCBWILG-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)