cas: 95093-58-6 — see every product listed under this CAS number, including other names
2-Hydroxypropyl 2-(4-isobutylphenyl)propanoate 95% (CAS 95093-58-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1235122-100mg |
| cas | 95093-58-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1104.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1235122 |
2-hydroxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate (CAS 95093-58-6) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 2-hydroxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: VUCGZWWOXKSFFZ-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 2-hydroxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | VUCGZWWOXKSFFZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)OCC(C)O |
Computed by PubChem (NCBI)