CAS 197243-48-4 appears in our catalog under these names: 2-Iodo-3-nitrophenol, 95%, 2-IODO-3-NITROPHENOL, ≥95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-iodo-3-nitrophenol (CAS 197243-48-4) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 2-iodo-3-nitrophenol. InChIKey: BFXOSMOZBIBXHU-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 2-iodo-3-nitrophenol |
| InChIKey | BFXOSMOZBIBXHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)