CAS 197243-46-2 appears in our catalog under these names: 2–Iodo–5–nitrophenol, 2-Iodo-5-nitrophenol, 2-Iodo-5-nitrophenol, 98%, 2-Iodo-5-nitrophenol 98%, 2-Iodo-5-nitrophenol, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g, 100mg.
2-iodo-5-nitrophenol (CAS 197243-46-2) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 2-iodo-5-nitrophenol. InChIKey: KUACYTMKOLNBNK-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 2-iodo-5-nitrophenol |
| InChIKey | KUACYTMKOLNBNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)I |
Computed by PubChem (NCBI)