Products 60728-70-3

CAS 60728-70-3 is the registry number for 5-Hydroxy-6-iodopicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-hydroxy-6-iodopyridine-2-carboxylic acid (CAS 60728-70-3) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 5-hydroxy-6-iodopyridine-2-carboxylic acid. InChIKey: XFCLVVRAEPZKNU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4INO3
Molecular weight265.01 g/mol
IUPAC name5-hydroxy-6-iodopyridine-2-carboxylic acid
InChIKeyXFCLVVRAEPZKNU-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1O)I)C(=O)O

Computed by PubChem (NCBI)