Products 50590-07-3
CAS 50590-07-3 appears in our catalog under these names: 3-Iodo-4-nitrophenol 97%, 3-Iodo-4-nitrophenol, 96%, 3-Iodo-4-nitrophenol, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
3-iodo-4-nitrophenol (CAS 50590-07-3) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 3-iodo-4-nitrophenol. InChIKey: FIWCMSJAIDKMNX-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 3-iodo-4-nitrophenol |
| InChIKey | FIWCMSJAIDKMNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-Iodo-4-nitrophenol, Phenol, 3-iodo-4-nitro-