Products 13073-26-2
CAS 13073-26-2 appears in our catalog under these names: 2-Iodo-6-nitrophenol, 95%, 2-Iodo-6-nitrophenol, 97%, 2-Iodo-6-nitro-phenol, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
2-iodo-6-nitrophenol (CAS 13073-26-2) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 2-iodo-6-nitrophenol. InChIKey: UGDVZTHIEZAYRU-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 2-iodo-6-nitrophenol |
| InChIKey | UGDVZTHIEZAYRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)