Products 861010-57-3
CAS 861010-57-3 appears in our catalog under these names: 3-Iodo-2-nitrophenol, 3–Iodo–2–nitrophenol, 3-Iodo-2-nitrophenol, 95%, 3-Iodo-2-nitrophenol 96%, 3-IODO-2-NITROPHENOL, 98%. Offered by: TRC, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
3-iodo-2-nitrophenol (CAS 861010-57-3) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 3-iodo-2-nitrophenol. InChIKey: DVEGEGXFFSZLBG-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 3-iodo-2-nitrophenol |
| InChIKey | DVEGEGXFFSZLBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)[N+](=O)[O-])O |
Computed by PubChem (NCBI)