CAS 89487-91-2 appears in our catalog under these names: 2-Iodo-4-nitrophenol 98%, 2-Iodo-4-nitrophenol, 98%, 2-Iodo-4-nitrophenol, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-iodo-4-nitrophenol (CAS 89487-91-2) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 2-iodo-4-nitrophenol. InChIKey: BKQFOYCEUMVWOW-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 2-iodo-4-nitrophenol |
| InChIKey | BKQFOYCEUMVWOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)O |
Computed by PubChem (NCBI)