CAS 60515-72-2 appears in our catalog under these names: 2-Isopropyl-4-nitrophenol, 98%, 2-Isopropyl-4-nitrophenol, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
4-nitro-2-propan-2-ylphenol (CAS 60515-72-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 4-nitro-2-propan-2-ylphenol. InChIKey: YVSKFUMSIJTGTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4-nitro-2-propan-2-ylphenol |
| InChIKey | YVSKFUMSIJTGTO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)