cas: 7545-71-3 — see every product listed under this CAS number, including other names
2-Isopropyl-6-nitrophenol 95% (CAS 7545-71-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A574766-1g |
| cas | 7545-71-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1772.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A574766 |
2-nitro-6-propan-2-ylphenol (CAS 7545-71-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-nitro-6-propan-2-ylphenol. InChIKey: RRFSVDKJKYCCEK-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-nitro-6-propan-2-ylphenol |
| InChIKey | RRFSVDKJKYCCEK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)