cas: 214360-78-8 — see every product listed under this CAS number, including other names
2-Mesityl-5,5-dimethyl-1,3,2-dioxaborinane 95% (CAS 214360-78-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A336028-250mg |
| cas | 214360-78-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 253.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A336028 |
5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane (CAS 214360-78-8) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane. InChIKey: ITLDRNGUSKUMRG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | ITLDRNGUSKUMRG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)