cas: 214360-78-8 — see every product listed under this CAS number, including other names
2,4,6-Trimethylphenylboronic acid neopentyl glycol ester, 95%, 95% (CAS 214360-78-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FNO-5g |
| cas | 214360-78-8 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 779.60 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 242.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane (CAS 214360-78-8) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane. InChIKey: ITLDRNGUSKUMRG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | ITLDRNGUSKUMRG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)