cas: 67827-72-9 — see every product listed under this CAS number, including other names
2-Methoxy-5-nitroaniline hydrochloride (CAS 67827-72-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037368-5G |
| cas | 67827-72-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 190.58 Pln |
| delivery time | 3-4 weeks |
|---|
2-methoxy-5-nitroaniline;hydrochloride (CAS 67827-72-9) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 2-methoxy-5-nitroaniline;hydrochloride. InChIKey: JBBNYKPRONOPHN-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 2-methoxy-5-nitroaniline;hydrochloride |
| InChIKey | JBBNYKPRONOPHN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)