CAS 944736-37-2 is the registry number for 3-Methoxy-4-nitroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
3-methoxy-4-nitroaniline;hydrochloride (CAS 944736-37-2) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 3-methoxy-4-nitroaniline;hydrochloride. InChIKey: ZXPPZDYKBVOLNJ-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 3-methoxy-4-nitroaniline;hydrochloride |
| InChIKey | ZXPPZDYKBVOLNJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)