CAS 177960-41-7 appears in our catalog under these names: 3,5-Diamino-2-hydroxybenzoic acid hydrochloride, 97%, 3,5–Diamino–2–hydroxybenzoic acid hydrochloride, 3,5-Diamino-2-hydroxybenzoic acid hydrochloride 97%, 3,5-Diamino-2-hydroxybenzoic acid hydrochloride, 97% ,, 97% ,, 3,5-Diamino-2-hydroxybenzoic acid hydrochloride. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
3,5-diamino-2-hydroxybenzoic acid;hydrochloride (CAS 177960-41-7) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 3,5-diamino-2-hydroxybenzoic acid;hydrochloride. InChIKey: JGWMDXDSLNLAFI-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 3,5-diamino-2-hydroxybenzoic acid;hydrochloride |
| InChIKey | JGWMDXDSLNLAFI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)N.Cl |
Computed by PubChem (NCBI)