CAS 29605-76-3 is the registry number for O-(3-Nitrobenzyl)hydroxylamine hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
O-[(3-nitrophenyl)methyl]hydroxylamine;hydrochloride (CAS 29605-76-3) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: O-[(3-nitrophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: VHTDJDWKRJRXDM-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | O-[(3-nitrophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | VHTDJDWKRJRXDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CON.Cl |
Computed by PubChem (NCBI)