CAS 2388475-91-8 is the registry number for 3-Chloro-4-(ethoxycarbonyl)-1-methyl-1H-pyrazole 2-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-chloro-1-methyl-2-oxidopyrazol-2-ium-4-carboxylate (CAS 2388475-91-8) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: ethyl 3-chloro-1-methyl-2-oxidopyrazol-2-ium-4-carboxylate. InChIKey: ZZGCRICSMRJCIX-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | ethyl 3-chloro-1-methyl-2-oxidopyrazol-2-ium-4-carboxylate |
| InChIKey | ZZGCRICSMRJCIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN([N+](=C1Cl)[O-])C |
Computed by PubChem (NCBI)