CAS 113186-97-3 appears in our catalog under these names: 2-(Aminomethyl)-4-nitrophenol hydrochloride, 95%, 2-(Aminomethyl)-4-nitrophenol hydrochloride, 98%, 2-(Aminomethyl)-4-nitrophenol hydrochloride, 2-(Aminomethyl)-4-nitrophenol hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g, 50mg, 500mg.
2-(aminomethyl)-4-nitrophenol;hydrochloride (CAS 113186-97-3) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 2-(aminomethyl)-4-nitrophenol;hydrochloride. InChIKey: BCEWUQSDFWXWQW-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 2-(aminomethyl)-4-nitrophenol;hydrochloride |
| InChIKey | BCEWUQSDFWXWQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CN)O.Cl |
Computed by PubChem (NCBI)