CAS 67827-72-9 appears in our catalog under these names: 2-Methoxy-5-nitroaniline hydrochloride, 98%, 2-Methoxy-5-nitroaniline hydrochloride, 98%+,RG, 98%+,RG, 2-Methoxy-5-nitroaniline hydrochloride. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
2-methoxy-5-nitroaniline;hydrochloride (CAS 67827-72-9) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 2-methoxy-5-nitroaniline;hydrochloride. InChIKey: JBBNYKPRONOPHN-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 2-methoxy-5-nitroaniline;hydrochloride |
| InChIKey | JBBNYKPRONOPHN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)