cas: 374538-03-1 — see every product listed under this CAS number, including other names
2-Methoxycarbonylphenylboronic acid, 97% (CAS 374538-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 433910010 |
| cas | 374538-03-1 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 169.71 Pln | |
| Thermo Scientific (Acros) | 5g | 538.99 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 1070.47 Pln | |
| Fluorochem | 500g | 4980.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(2-methoxycarbonylphenyl)boronic acid (CAS 374538-03-1) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (2-methoxycarbonylphenyl)boronic acid. InChIKey: ODAXNYMENLFYMY-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (2-methoxycarbonylphenyl)boronic acid |
| InChIKey | ODAXNYMENLFYMY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)OC)(O)O |
Computed by PubChem (NCBI)