CAS 164014-95-3 appears in our catalog under these names: 1,4-Benzodioxane-6-boronic acid/ 95+%, 6-(1,4-BENZODIOXANYL)BORONIC ACID,>=95%, 1,4–Benzodioxane–6–boronic acid, 1,4-Benzodioxane-6-boronic acid, 97% , 1,4-Benzodioxane-6-boronic Acid (contains varying amounts of Anhydride). Offered by: Chemat, Sigma-Aldrich, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100g, 500g, 1kg.
2,3-dihydro-1,4-benzodioxin-6-ylboronic acid (CAS 164014-95-3) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-6-ylboronic acid. InChIKey: SQDUGGGBJXULJR-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-6-ylboronic acid |
| InChIKey | SQDUGGGBJXULJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCO2)(O)O |
Computed by PubChem (NCBI)