CAS 1951-38-8 appears in our catalog under these names: 2–Methoxyisophthalic acid, 2-Methoxyisophthalic acid, 97%, 97%, 2-Methoxyisophthalic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g.
2-methoxybenzene-1,3-dicarboxylic acid (CAS 1951-38-8) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-methoxybenzene-1,3-dicarboxylic acid. InChIKey: ZRWAPLTWCQQSAN-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-methoxybenzene-1,3-dicarboxylic acid |
| InChIKey | ZRWAPLTWCQQSAN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)