CAS 14963-97-4 appears in our catalog under these names: 3-Methoxyphthalic acid, 96%, 3-Methoxyphthalic Acid, 3–Methoxyphthalic acid, 1,2-Benzenedicarboxylic acid, 3-methoxy-, 96%, 96%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10mg, 2,5mg, 25mg, 100mg, 250mg, 10g.
3-methoxyphthalic acid (CAS 14963-97-4) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 3-methoxyphthalic acid. InChIKey: DULQZGQVLHMCAU-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-methoxyphthalic acid |
| InChIKey | DULQZGQVLHMCAU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)