CAS 1878-61-1 appears in our catalog under these names: 3-(Carboxymethoxy)benzoic acid, 95%, 3-(Carboxymethoxy)benzoic acid, 97%, 3–(Carboxymethoxy)benzoic acid, 3-(carboxymethoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg, 0,5g.
3-(carboxymethoxy)benzoic acid (CAS 1878-61-1) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 3-(carboxymethoxy)benzoic acid. InChIKey: GXFAJSDLPLCRIQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-(carboxymethoxy)benzoic acid |
| InChIKey | GXFAJSDLPLCRIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)