CAS 2377643-33-7 appears in our catalog under these names: 4-Methoxy-3-(tetrahydro-2,4-dioxo-1(2H)-pyrimidinyl)benzoic acid, 98%, 98%, 2-Methoxyphenyl dihydrouracil, 98.0%, 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-4-methoxybenzoic acid, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 250 mg.
3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoic acid (CAS 2377643-33-7) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoic acid. InChIKey: HCEOVKWPVMWQJA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoic acid |
| InChIKey | HCEOVKWPVMWQJA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)N2CCC(=O)NC2=O |
Computed by PubChem (NCBI)