CAS 885953-94-6 is the registry number for (7,8-Dimethoxy-1-oxophthalazin-2(1h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetic acid (CAS 885953-94-6) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetic acid. InChIKey: PXVBMXPFVIUDQY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetic acid |
| InChIKey | PXVBMXPFVIUDQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=NN(C2=O)CC(=O)O)OC |
Computed by PubChem (NCBI)