Products 2633725-29-6
CAS 2633725-29-6 appears in our catalog under these names: 2-(3-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)phenoxy)acetic acid, 98%, A-1744428.0, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
2-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid (CAS 2633725-29-6) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid. InChIKey: ZKJTZHUURIFLRN-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid |
| InChIKey | ZKJTZHUURIFLRN-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=CC=C2)OCC(=O)O |
Computed by PubChem (NCBI)