Products 66570-46-5
CAS 66570-46-5 is the registry number for 5,8-Dimethoxy-4-methyl-6-nitroquinolin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dimethoxy-4-methyl-6-nitro-1H-quinolin-2-one (CAS 66570-46-5) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 5,8-dimethoxy-4-methyl-6-nitro-1H-quinolin-2-one. InChIKey: AKMCTEULHHKOAO-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 5,8-dimethoxy-4-methyl-6-nitro-1H-quinolin-2-one |
| InChIKey | AKMCTEULHHKOAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C(C=C(C(=C12)OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)