CAS 1260835-39-9 is the registry number for [(3-Phenyl-5-isoxazolyl)methyl]amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Oxalic acid;(3-phenyl-1,2-oxazol-5-yl)methanamine (CAS 1260835-39-9) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: oxalic acid;(3-phenyl-1,2-oxazol-5-yl)methanamine. InChIKey: IOEDYUDBNPSPAU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | oxalic acid;(3-phenyl-1,2-oxazol-5-yl)methanamine |
| InChIKey | IOEDYUDBNPSPAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)