CAS 1384080-85-6 is the registry number for Methyl 3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1384080-85-6) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: PNFIXCZBPYLEPA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | PNFIXCZBPYLEPA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=NOC(=N2)C(=O)OC)OC |
Computed by PubChem (NCBI)