Products 1160264-10-7

CAS 1160264-10-7 is the registry number for 1-(4-Methyl-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(4-methyl-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1160264-10-7) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 1-(4-methyl-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: GIYVNRRHVAOLEB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O5
Molecular weight264.23 g/mol
IUPAC name1-(4-methyl-2-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyGIYVNRRHVAOLEB-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)N2CC(CC2=O)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)