2-Methyl-1-naphthalenecarboxaldehyde, 95%
cas: 35699-44-6 — see every product listed under this CAS number, including other names
2-Methyl-1-naphthalenecarboxaldehyde, 95% (CAS 35699-44-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A370969-250mg |
| cas | 35699-44-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 715.25 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 3078.80 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 764.20 Pln | |
| Fluorochem | 250mg | 523.79 Pln | |
| Fluorochem | 1g | 1242.29 Pln | |
| Fluorochem | 5g | 5709.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-methylnaphthalene-1-carbaldehyde (CAS 35699-44-6) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 2-methylnaphthalene-1-carbaldehyde. InChIKey: WIAZTPUQHUFMQA-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-methylnaphthalene-1-carbaldehyde |
| InChIKey | WIAZTPUQHUFMQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)C=O |
Computed by PubChem (NCBI)