CAS 136896-92-9 appears in our catalog under these names: 6-Vinylnaphthalen-2-ol, 95%, 6–Vinylnaphthalen–2–ol, 6-Vinylnaphthalen-2-ol 95%, 6-Vinylnaphthalen-2-ol, 95%, 95%, 6-Vinylnaphthalen-2-ol, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
6-ethenylnaphthalen-2-ol (CAS 136896-92-9) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 6-ethenylnaphthalen-2-ol. InChIKey: XVZWMPLMWUJTCE-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 6-ethenylnaphthalen-2-ol |
| InChIKey | XVZWMPLMWUJTCE-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)