CAS 1126389-67-0 is the registry number for 4-Hydroxy Biphenyl-D5. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1mg, 5mg.
4-(2,3,4,5,6-pentadeuteriophenyl)phenol (CAS 1126389-67-0) is a chemical compound with the molecular formula C12H10O and a molecular weight of 175.24 g/mol. IUPAC name: 4-(2,3,4,5,6-pentadeuteriophenyl)phenol. InChIKey: YXVFYQXJAXKLAK-RALIUCGRSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 175.24 g/mol |
| IUPAC name | 4-(2,3,4,5,6-pentadeuteriophenyl)phenol |
| InChIKey | YXVFYQXJAXKLAK-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=C(C=C2)O)[2H])[2H] |
Computed by PubChem (NCBI)