CAS 104306-72-1 is the registry number for 5-Methylnaphthalene-1-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-methylnaphthalene-1-carbaldehyde (CAS 104306-72-1) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 5-methylnaphthalene-1-carbaldehyde. InChIKey: ZIEGRROGVACHKT-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 5-methylnaphthalene-1-carbaldehyde |
| InChIKey | ZIEGRROGVACHKT-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=C(C2=CC=C1)C=O |
Computed by PubChem (NCBI)