CAS 6306-07-6 appears in our catalog under these names: 1-Acenaphthenol, 98%, 1-Acenaphthenol, >95% (HPLC), 1-Acenaphthenol/ 99%, 1-Acenaphthenol, >97.0%(GC), 1-Acenaphthenol 98%. Offered by: Combi-blocks, TRC, Chemat, TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 250mg.
1,2-dihydroacenaphthylen-1-ol (CAS 6306-07-6) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-1-ol. InChIKey: MXUCIEHYJYRTLT-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-1-ol |
| InChIKey | MXUCIEHYJYRTLT-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC3=C2C1=CC=C3)O |
Computed by PubChem (NCBI)