CAS 139988-09-3 is the registry number for 7-Ethynyl-3,4-dihydronaphthalen-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-ethynyl-3,4-dihydro-1H-naphthalen-2-one (CAS 139988-09-3) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 7-ethynyl-3,4-dihydro-1H-naphthalen-2-one. InChIKey: VSYKXHCYXBLHGV-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 7-ethynyl-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | VSYKXHCYXBLHGV-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(CCC(=O)C2)C=C1 |
Computed by PubChem (NCBI)