CAS 941-98-0 appears in our catalog under these names: 1'-Acetonaphthone, 98%, 98%, 1-Acetylnaphthalene, 1'–Acetylnaphthalene, 1-Acetylnaphthalene, 97+% , 1'-Acetonaphthone, 95%. Offered by: Chemat, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Available pack sizes: 10g, 25g, 100g, 500g, 1kg, 5kg, 10kg, 50kg.
1-naphthalen-1-ylethanone (CAS 941-98-0) is a chemical compound with the molecular formula C12H10O and a molecular weight of 170.21 g/mol. IUPAC name: 1-naphthalen-1-ylethanone. InChIKey: QQLIGMASAVJVON-UHFFFAOYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 1-naphthalen-1-ylethanone |
| InChIKey | QQLIGMASAVJVON-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)