2-Methyl-2H-indazole-7-carboxylic acid, 98%
cas: 1234615-75-8 — see every product listed under this CAS number, including other names
2-Methyl-2H-indazole-7-carboxylic acid, 98% (CAS 1234615-75-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A986916-250mg |
| cas | 1234615-75-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 659.60 Pln | |
| Chemat | 10g | 1259.60 Pln | |
| Chemat | 25g | 2939.60 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 914.15 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-methylindazole-7-carboxylic acid (CAS 1234615-75-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-methylindazole-7-carboxylic acid. InChIKey: ZEBWGCUXSPBILS-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-methylindazole-7-carboxylic acid |
| InChIKey | ZEBWGCUXSPBILS-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=CC=C(C2=N1)C(=O)O |
Computed by PubChem (NCBI)
