2-Methyl-4-nitrophenylboronic acid, 98%
cas: 1228829-54-6 — see every product listed under this CAS number, including other names
2-Methyl-4-nitrophenylboronic acid, 98% (CAS 1228829-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111JOB-100mg |
| cas | 1228829-54-6 |
| size | 100mg |
| availability | 35g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1350.80 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1606.74 Pln | |
| Fluorochem | 10g | 3132.25 Pln | |
| Fluorochem | 25g | 7505.71 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-methyl-4-nitrophenyl)boronic acid (CAS 1228829-54-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (2-methyl-4-nitrophenyl)boronic acid. InChIKey: MTRNMFMWHXCMFQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (2-methyl-4-nitrophenyl)boronic acid |
| InChIKey | MTRNMFMWHXCMFQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)[N+](=O)[O-])C)(O)O |
Computed by PubChem (NCBI)