CAS 151104-37-9 appears in our catalog under these names: 2-Methyl-5-(methylsulfonyl)benzoic acid, 95%, 2-Methyl-5-(methylsulfonyl)benzoic Acid, 95+%, 2–Methyl–5–(methylsulfonyl)benzoic Acid, 2-Methyl-5-(methylsulfonyl)benzoic acid, 2-Methyl-5-(methylsulfonyl)benzoic Acid, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg.
2-methyl-5-methylsulfonylbenzoic acid (CAS 151104-37-9) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 2-methyl-5-methylsulfonylbenzoic acid. InChIKey: KRVIUQHVAZLPNU-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 2-methyl-5-methylsulfonylbenzoic acid |
| InChIKey | KRVIUQHVAZLPNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)