CAS 1186663-49-9 appears in our catalog under these names: 2-Methyl-3-(methylsulfonyl)benzoic acid, 95%, 2–Methyl–3–(methylsulfonyl)benzoic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
2-methyl-3-methylsulfonylbenzoic acid (CAS 1186663-49-9) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 2-methyl-3-methylsulfonylbenzoic acid. InChIKey: WMALKKDIJHZYRM-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 2-methyl-3-methylsulfonylbenzoic acid |
| InChIKey | WMALKKDIJHZYRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)