cas: 306936-43-6 — see every product listed under this CAS number, including other names
2-Methyl-5-(pyrrolidin-1-ylsulfonyl)furan-3-carboxylic acid, 97% (CAS 306936-43-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F723299-250MG |
| cas | 306936-43-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 2663.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-5-pyrrolidin-1-ylsulfonylfuran-3-carboxylic acid (CAS 306936-43-6) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 2-methyl-5-pyrrolidin-1-ylsulfonylfuran-3-carboxylic acid. InChIKey: QOGZFCGDYUTGTO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-methyl-5-pyrrolidin-1-ylsulfonylfuran-3-carboxylic acid |
| InChIKey | QOGZFCGDYUTGTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)S(=O)(=O)N2CCCC2)C(=O)O |
Computed by PubChem (NCBI)