CAS 71675-87-1 appears in our catalog under these names: Amisulpride EP Impurity E, Amisulpride Impurity 5（Amisulpride EP Impurity E), 2-Methoxy-4-amino-5-ethylsulfonylbenzoic Acid, >95% (HPLC), 4-Amino-5-(ethylsulphonyl)-2-methoxybenzoic Acid, 4–Amino–5–(ethylsulfonyl)–2–methoxybenzoic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 100g, 25g.
4-amino-5-ethylsulfonyl-2-methoxybenzoic acid (CAS 71675-87-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid. InChIKey: OJVNCXHGGYYOPH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)OC)N |
Computed by PubChem (NCBI)