cas: 32046-51-8 — see every product listed under this CAS number, including other names
2-Methyl-5-nitrobenzoxazole 98% (CAS 32046-51-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260379-250mg |
| cas | 32046-51-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 843.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260379 |
2-methyl-5-nitro-1,3-benzoxazole (CAS 32046-51-8) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-methyl-5-nitro-1,3-benzoxazole. InChIKey: UCZSXRHVXKAGFU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-methyl-5-nitro-1,3-benzoxazole |
| InChIKey | UCZSXRHVXKAGFU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)