CAS 291289-41-3 appears in our catalog under these names: 2-Oxo-2,3-dihydro-1h-benzo[d]imidazole-4-carboxylic acid, 96%, 2-Oxo-2,3-dihydro-1H-benzo(d)imidazole-4-carboxylic acid, 97%, 2–Oxo–2,3–dihydro–1H–benzo(d)imidazole–4–carboxylic acid, 2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid 97%, 2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid (CAS 291289-41-3) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid. InChIKey: NEGPAVSXSLHMAR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid |
| InChIKey | NEGPAVSXSLHMAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)